CAS 720696-45-7
:1-(naphthalen-2-ylmethyl)-1H-indole-3-carbaldehyde
Description:
1-(Naphthalen-2-ylmethyl)-1H-indole-3-carbaldehyde is an organic compound characterized by its complex structure, which includes an indole moiety and a naphthyl group. This compound features a carbonyl group (aldehyde) attached to the indole, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the naphthyl group enhances its aromatic character, which can influence its electronic properties and interactions with biological targets. Typically, compounds like this may exhibit fluorescence, making them useful in various applications, including as fluorescent probes or in the development of organic light-emitting diodes (OLEDs). The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Additionally, due to its structural features, it may exhibit interesting biological activities, warranting further investigation in pharmacological studies. Overall, 1-(naphthalen-2-ylmethyl)-1H-indole-3-carbaldehyde represents a versatile scaffold in organic chemistry with potential implications in various fields.
Formula:C20H15NO
InChI:InChI=1/C20H15NO/c22-14-18-13-21(20-8-4-3-7-19(18)20)12-15-9-10-16-5-1-2-6-17(16)11-15/h1-11,13-14H,12H2
SMILES:c1ccc2cc(ccc2c1)Cn1cc(C=O)c2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.