CAS 720696-71-9
:5-(2,5-dimethylphenyl)-1H-pyrazole-4-carbaldehyde
Description:
5-(2,5-Dimethylphenyl)-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carbaldehyde functional group, indicating the presence of an aldehyde (-CHO) moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 2,5-dimethylphenyl substituent enhances its hydrophobic character and may influence its biological activity. Typically, compounds like this can exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the electrophilic nature of the aldehyde group. Its unique structure may allow for applications in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H12N2O
InChI:InChI=1/C12H12N2O/c1-8-3-4-9(2)11(5-8)12-10(7-15)6-13-14-12/h3-7H,1-2H3,(H,13,14)
SMILES:Cc1ccc(C)c(c1)c1c(c[nH]n1)C=O
Synonyms:- 1H-pyrazole-4-carboxaldehyde, 3-(2,5-dimethylphenyl)-
- 3-(2,5-dimethylphenyl)-1H-pyrazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
