CAS 7207-97-8

Arsonous diiodide, methyl-

Description:

Arsonous diiodide, methyl- is an organoarsenic compound characterized by the presence of arsenic, iodine, and a methyl group. Its chemical structure typically features a central arsenic atom bonded to two iodine atoms and one methyl group, which contributes to its unique properties. This compound is known for its potential toxicity, as organoarsenic compounds can exhibit harmful effects on biological systems. The presence of iodine atoms may influence its reactivity and stability, making it of interest in various chemical applications, including potential uses in organic synthesis or as a reagent in chemical reactions. However, due to its toxic nature, handling and disposal require strict safety precautions. Additionally, the compound's behavior in different solvents and under varying conditions can provide insights into its reactivity and potential applications in research. As with all organometallic compounds, understanding its properties is crucial for safe and effective use in laboratory settings.

Formula: CH₃AsI₂

InChI: InChI=1S/CH3AsI2/c1-2(3)4/h1H3

InChI key: InChIKey=ZKGSUVMABCXPKK-UHFFFAOYSA-N

SMILES: [As](C)(I)I

Synonyms:

• Arsine, diiodomethyl-
• Methyldiiodoarsine
• Diiodomethylarsine
• Arsonous diiodide, methyl-
• Methylarsine diiodide