CAS 720706-28-5

(5-methyl-1H-1,2,4-triazol-3-yl)acetic acid

Description:

(5-Methyl-1H-1,2,4-triazol-3-yl)acetic acid is a chemical compound characterized by its triazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the methyl group at the 5-position of the triazole ring enhances its lipophilicity, potentially influencing its interaction with biological targets. The acetic acid functional group provides acidity and can participate in hydrogen bonding, which is crucial for its solubility and reactivity. This compound is often studied for its role in various biochemical pathways and may exhibit antifungal or antimicrobial properties due to the triazole moiety, which is known for its ability to inhibit specific enzymes in pathogens. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-3-6-4(8-7-3)2-5(9)10/h2H2,1H3,(H,9,10)(H,6,7,8)

SMILES: Cc1nc(CC(=O)O)n[nH]1

Synonyms:

• (3-Methyl-1H-1,2,4-triazol-5-yl)acetic acid
• 1H-1,2,4-triazole-3-acetic acid, 5-methyl-
• 1H-1,2,4-triazole-5-acetic acid, 3-methyl-
• 3-methyl-1H-1,2,4-Triazole-5-acetic acid
• (5-Methyl-1H-1,2,4-triazol-3-yl)acetic acid

2-(5-Methyl-4H-1,2,4-triazol-3-yl)acetic acid

CAS: 720706-28-5

Formula: C₅H₇N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.1280

Ref: IN-DA005DAO

(5-Methyl-2H-[1,2,4]triazol-3-yl)-acetic acid

CAS: 720706-28-5

(5-Methyl-2H-[1,2,4]triazol-3-yl)-acetic acid

Purity: 95%

Molecular weight: 141.13g/mol

Ref: 54-OR73772

2-(5-Methyl-4H-1,2,4-triazol-3-yl)acetic acid

CAS: 720706-28-5

Formula: C₅H₇N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.13

Ref: 10-F220090

2-(5-Methyl-4H-1,2,4-triazol-3-yl)acetic Acid

Controlled Product

CAS: 720706-28-5

Formula: C₅H₇N₃O₂

Color and Shape: Neat

Molecular weight: 141.128

Ref: TR-M305760