
CAS 72075-06-0
:myo-Inositol, 1-amino-1,2-dideoxy-
Description:
Myo-Inositol, 1-amino-1,2-dideoxy- is a chemical compound characterized by its structural features as a derivative of inositol, which is a cyclic sugar alcohol. This compound contains an amino group and two hydroxymethyl groups, contributing to its solubility in water and its role in various biological processes. It is often involved in cellular signaling and is a precursor for phospholipids and other important biomolecules. The presence of the amino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting metabolic disorders. Myo-Inositol derivatives are also studied for their roles in neuroprotection and insulin sensitivity. The CAS number 72075-06-0 uniquely identifies this compound, facilitating its recognition in scientific literature and regulatory contexts. Overall, myo-Inositol, 1-amino-1,2-dideoxy- exhibits properties that make it significant in both biochemical research and potential therapeutic applications.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/t2-,3+,4+,5-,6-/s2
InChI key:InChIKey=QXQNRSUOYNMXDL-JIJCMNCTNA-N
SMILES:O[C@H]1[C@H](O)[C@@H](O)[C@H](O)C[C@@H]1N
Synonyms:- 1-Amino-1,2-dideoxy-myo-inositol
- myo-Inositol, 1-amino-1,2-dideoxy-
- 1-Amino-1,2-dideoxy-scyllo-inositol
- 1-Amino-1,2-dideoxy-DL-scyllo-inositol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.