CymitQuimica logo

CAS 72079-77-7

:

4,7-dihydroimidazo[4,5-d][1,3]diazepin-8(1H)-one

Description:
4,7-Dihydroimidazo[4,5-d][1,3]diazepin-8(1H)-one is a heterocyclic compound characterized by its fused imidazole and diazepine rings. This compound features a bicyclic structure that incorporates nitrogen atoms, contributing to its potential biological activity. It typically exhibits properties such as moderate solubility in polar solvents and may display basic characteristics due to the presence of nitrogen atoms in the ring system. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including anxiolytic and anticonvulsant effects. Its structure allows for various substitutions, which can influence its biological activity and pharmacokinetic properties. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, which can be crucial for its interactions with biological targets. Overall, 4,7-dihydroimidazo[4,5-d][1,3]diazepin-8(1H)-one represents a class of compounds with significant potential in drug development and therapeutic applications.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c11-4-1-7-2-9-6-5(4)8-3-10-6/h2-3H,1H2,(H,7,9)(H,8,10)
SMILES:C1C(=O)c2c(NC=N1)[nH]cn2
Synonyms:
  • 4,7-Dihydro-imidazole[4,5-d]1,3-diazepine-8(1H)-one
  • 6,7-Dihydroimidazo[4,5-d][1,3]diazepin-8(3H)-one
  • imidazo[4,5-d][1,3]diazepin-8(3H)-one, 6,7-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.