CAS 72085-01-9

N-{2-[(2-hydroxyethyl)amino]-2-oxoethyl}benzamide

Description:

N-{2-[(2-hydroxyethyl)amino]-2-oxoethyl}benzamide, identified by its CAS number 72085-01-9, is a chemical compound that features a benzamide structure with a specific substitution pattern. This compound contains an amide functional group, which is characterized by the presence of a carbonyl group (C=O) directly attached to a nitrogen atom (N). The presence of a hydroxyethyl group indicates that it has both hydroxyl (-OH) and amino (-NH) functionalities, contributing to its potential solubility in polar solvents. The oxoethyl moiety suggests that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, N-{2-[(2-hydroxyethyl)amino]-2-oxoethyl}benzamide represents a versatile structure with potential applications in medicinal chemistry.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1/C11H14N2O3/c14-7-6-12-10(15)8-13-11(16)9-4-2-1-3-5-9/h1-5,14H,6-8H2,(H,12,15)(H,13,16)

Synonyms:

• N-{2-[(2-Hydroxyethyl)amino]-2-oxoethyl}benzamide
• benzamide, N-[2-[(2-hydroxyethyl)amino]-2-oxoethyl]-