CAS 72089-08-8
:Brahmanol
Description:
Brahmanol, with the CAS number 72089-08-8, is a chemical compound that belongs to the class of natural products, specifically a type of sesquiterpene alcohol. It is primarily derived from certain plant sources and is known for its potential applications in the fragrance and flavor industry due to its pleasant aroma. Brahmanol exhibits characteristics typical of sesquiterpenes, including a complex structure that contributes to its unique scent profile. The compound is generally recognized for its stability under various conditions, making it suitable for use in formulations. Additionally, Brahmanol may possess biological activities, although specific pharmacological properties and mechanisms of action require further investigation. Its solubility characteristics can vary, often being more soluble in organic solvents than in water. As with many natural compounds, the purity and concentration can significantly influence its properties and applications. Overall, Brahmanol represents an interesting subject of study within the realm of natural products chemistry and its potential uses in various industries.
Formula:C13H24O
InChI:InChI=1S/C13H24O/c1-10(9-14)5-7-12-8-6-11(2)13(12,3)4/h6,10,12,14H,5,7-9H2,1-4H3
InChI key:InChIKey=CYVGAJHMMVDTDZ-UHFFFAOYSA-N
SMILES:C(CC(CO)C)C1C(C)(C)C(C)=CC1
Synonyms:- 2-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)butanol
- 2-Methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)butan-1-ol
- 3-Cyclopentene-1-butanol, beta,2,2,3-tetramethyl-
- 3-Cyclopentene-1-butanol, β,2,2,3-tetramethyl-
- Brahmanol
- beta,2,2,3-Tetramethylcyclopent-3-ene-1-butanol
- β,2,2,3-Tetramethyl-3-cyclopentene-1-butanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.