CAS 72093-08-4

5-Chloro-2,3-dimethylpyridine

Description:

5-Chloro-2,3-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine and methyl groups. Its molecular structure features a chlorine atom at the 5-position and two methyl groups at the 2 and 3 positions of the pyridine ring, contributing to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its moderate polarity, which influences its solubility in various organic solvents. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. Additionally, 5-Chloro-2,3-dimethylpyridine may exhibit biological activity, which can be explored in medicinal chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, its unique structure and reactivity make it a valuable compound in organic synthesis and research.

Formula: C₇H₈ClN

InChI: InChI=1S/C7H8ClN/c1-5-3-7(8)4-9-6(5)2/h3-4H,1-2H3

InChI key: InChIKey=PKZCOALHYWZNHP-UHFFFAOYSA-N

SMILES: CC1=C(C)N=CC(Cl)=C1

Synonyms:

• 5-Chloro-2,3-dimethylpyridine
• Pyridine, 5-chloro-2,3-dimethyl-