
CAS 72093-09-5
:5-Chloro-2,4-dimethylpyridine
Description:
5-Chloro-2,4-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine and methyl groups. Its molecular formula is C8H10ClN, indicating the presence of eight carbon atoms, ten hydrogen atoms, one chlorine atom, and one nitrogen atom. The compound features a chlorine atom at the 5-position and two methyl groups at the 2 and 4 positions of the pyridine ring, which influences its chemical reactivity and physical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. 5-Chloro-2,4-dimethylpyridine is soluble in organic solvents and exhibits moderate stability under standard conditions. It is primarily used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds due to its functional groups that can participate in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H8ClN
InChI:InChI=1S/C7H8ClN/c1-5-3-6(2)9-4-7(5)8/h3-4H,1-2H3
InChI key:InChIKey=WWBKMXBBBWWMKT-UHFFFAOYSA-N
SMILES:CC=1C(Cl)=CN=C(C)C1
Synonyms:- 5-Chloro-2,4-dimethylpyridine
- Pyridine, 5-chloro-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.