CAS 72093-21-1
:mastoparan
Description:
Mastoparan is a peptide derived from the venom of wasps, particularly from the species Vespula lewisii. It is characterized by its ability to interact with cell membranes and modulate various cellular processes. Structurally, mastoparan is composed of a sequence of amino acids that contribute to its amphipathic nature, allowing it to insert into lipid bilayers and disrupt membrane integrity. This property makes it a valuable tool in biochemical research, particularly in studies involving membrane dynamics and signal transduction. Mastoparan is known to activate G-proteins, which play a crucial role in transmitting signals from outside the cell to the inside, influencing various physiological responses. Additionally, it exhibits antimicrobial properties and has been studied for its potential applications in drug development and as a model for understanding membrane interactions. However, due to its origin from venom, caution is advised in its handling and application. Overall, mastoparan serves as an important compound in both toxicology and pharmacology research.
Formula:C70H131N19O15
InChI:InChI=1/C70H131N19O15/c1-17-40(11)55(75)69(103)88-53(35-54(74)90)68(102)87-52(34-39(9)10)67(101)83-46(25-19-22-28-71)62(96)78-45(16)61(95)86-50(32-37(5)6)65(99)79-42(13)58(92)77-43(14)60(94)85-51(33-38(7)8)66(100)80-44(15)59(93)81-47(26-20-23-29-72)63(97)82-48(27-21-24-30-73)64(98)89-56(41(12)18-2)70(104)84-49(57(76)91)31-36(3)4/h36-53,55-56H,17-35,71-73,75H2,1-16H3,(H2,74,90)(H2,76,91)(H,77,92)(H,78,96)(H,79,99)(H,80,100)(H,81,93)(H,82,97)(H,83,101)(H,84,104)(H,85,94)(H,86,95)(H,87,102)(H,88,103)(H,89,98)
SMILES:CCC(C)C(C(=NC(CC(=N)O)C(=NC(CC(C)C)C(=NC(CCCCN)C(=NC(C)C(=NC(CC(C)C)C(=NC(C)C(=NC(C)C(=NC(CC(C)C)C(=NC(C)C(=NC(CCCCN)C(=NC(CCCCN)C(=NC(C(C)CC)C(=NC(CC(C)C)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N
Synonyms:- Mastoparan Vespula Lewisii
- Mastoparan from Vespula lewisii
- H-Ile-Asn-Leu-Lys-Ala-Leu-Ala-Ala-Leu-Ala-Lys-Lys-Ile-Leu-NH2
- N-[1-[[5-amino-1-[[2-[[1-[[2-[[2-[[1-[[2-[[5-amino-1-[[5-amino-1-[[1-[(1-carbamoyl-3-methyl-butyl)carbamoyl]-2-methyl-butyl]carbamoyl]pentyl]carbamoyl]pentyl]amino]-1-methyl-2-oxo-ethyl]carbamoyl]-3-methyl-butyl]amino]-1-methyl-2-oxo-ethyl]amino]-1-methyl-2-oxo-ethyl]carbamoyl]-3-methyl-butyl]amino]-1-methyl-2-oxo-ethyl]carbamoyl]pentyl]carbamoyl]-3-methyl-butyl]-2-[(2-amino-3-methyl-pentanoyl)amino]butanediamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Mastoparan
CAS:Bachem ID: 4013168.
Formula:C70H131N19O15Purity:96.9%Color and Shape:WhiteMolecular weight:1478.93Mastoparan
CAS:Mastoparan is a peptide toxin from wasp venom. It has the chemical structure Ile-Asn-Leu-Lys-Ala-Leu-Ala-Ala-Leu-Ala-Lys-Lys-Ile-Leu-NH2.Formula:C70H131N19O15Purity:98%Color and Shape:SolidMolecular weight:1478.91Mastoparan Trifluoroacetic Acid Salt
CAS:Controlled ProductApplications Mastoparan Trifluoroacetic Acid Salt is a G-protein activator. Mastoparan activates phospholipase A2 and inhibits calmodulin.
References Delazari dos Santos, L., et al.: Proteomics, 12, 2682-2693 (2012);Formula:C70H131N19O15·x(C2HF3O2)Color and Shape:NeatMolecular weight:1478.91 + x(114.02)Mastoparan
CAS:Controlled ProductA cell-penetrating peptide toxin whose sequence is derived from wasp venom and a potent activator of heterotrimeric G proteins. This product is available as a 0.5mg vial. One letter code: INLKALAALAKKIL-NH2Formula:C70H131N19O15Purity:Min. 95%Molecular weight:1,478.9 g/mol





