CymitQuimica logo

CAS 72093-22-2

:

Mastoparan X

Description:
Mastoparan X is a peptide derived from the venom of wasps, specifically from the species Vespula lewisii. It is known for its ability to interact with cell membranes and modulate various biological processes. This substance is characterized by its amphipathic nature, which allows it to insert into lipid bilayers, leading to membrane destabilization and potential pore formation. Mastoparan X exhibits biological activities such as antimicrobial properties and the ability to stimulate the release of neurotransmitters and hormones. Its mechanism of action often involves the activation of G-proteins, which play a crucial role in signal transduction pathways. Additionally, Mastoparan X has been studied for its potential applications in drug delivery systems and as a tool in membrane biology research. Due to its origin from venom, it is important to handle this peptide with care, as it may elicit biological responses in living organisms. Overall, Mastoparan X serves as a valuable compound in both biochemical research and potential therapeutic applications.
Formula:C73H126N20O15S
InChI:InChI=1/C73H126N20O15S/c1-13-41(7)59(78)72(107)92-56(36-57(77)94)71(106)91-55(35-46-37-80-48-24-16-15-23-47(46)48)70(105)87-49(25-17-20-29-74)65(100)81-38-58(95)93-60(42(8)14-2)73(108)84-43(9)62(97)82-44(10)63(98)86-52(28-32-109-12)66(101)83-45(11)64(99)85-50(26-18-21-30-75)67(102)88-51(27-19-22-31-76)68(103)90-54(34-40(5)6)69(104)89-53(61(79)96)33-39(3)4/h15-16,23-24,37,39-45,49-56,59-60,80H,13-14,17-22,25-36,38,74-76,78H2,1-12H3,(H2,77,94)(H2,79,96)(H,81,100)(H,82,97)(H,83,101)(H,84,108)(H,85,99)(H,86,98)(H,87,105)(H,88,102)(H,89,104)(H,90,103)(H,91,106)(H,92,107)(H,93,95)/t41-,42-,43-,44-,45-,49-,50-,51-,52-,53-,54-,55-,56-,59-,60?/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](CC(=N)O)C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=N[C@@H](CCCCN)C(=NCC(=NC([C@@H](C)CC)C(=N[C@@H](C)C(=N[C@@H](C)C(=N[C@@H](CCSC)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](CC(C)C)C(=N[C@@H](CC(C)C)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N
Synonyms:
  • (2S)-N-[(1S)-2-[[(1S)-5-amino-1-[[2-[[(2S)-1-[[(1S)-2-[[(1S)-2-[[(1S)-1-[[(1S)-2-[[(1S)-5-amino-1-[[(1S)-5-amino-1-[[(1S)-1-[[(1S)-1-carbamoyl-3-methyl-butyl]carbamoyl]-3-methyl-butyl]carbamoyl]pentyl]carbamoyl]pentyl]amino]-1-methyl-2-oxo-ethyl]carbamoyl
  • H-Ile-Asn-Trp-Lys-Gly-Ile-Ala-Ala-Met-Ala-Lys-Lys-Leu-Leu-NH2
  • ILE-ASN-TRP-LYS-GLY-ILE-ALA-ALA-MET-ALA-LYS-LYS-LEU-LEU-NH2
  • MP-X
  • INWKGIAAMAKKLL-NH2
  • MASTOPARAN X
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.