CAS 72093-49-3
:3-Fluoro-4′-nitro-1,1′-biphenyl
Description:
3-Fluoro-4′-nitro-1,1′-biphenyl is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. The compound features a fluorine atom at the 3-position of one phenyl ring and a nitro group (-NO2) at the 4′-position of the adjacent phenyl ring. This substitution pattern contributes to its unique chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and materials science. The presence of the electronegative fluorine atom can influence the compound's electronic properties, while the nitro group can serve as a site for further chemical modifications. Additionally, 3-Fluoro-4′-nitro-1,1′-biphenyl may exhibit specific solubility characteristics and stability under various conditions, making it of interest for research and industrial applications. Its CAS number, 72093-49-3, allows for easy identification and reference in chemical databases and literature.
Formula:C12H8FNO2
InChI:InChI=1S/C12H8FNO2/c13-11-3-1-2-10(8-11)9-4-6-12(7-5-9)14(15)16/h1-8H
InChI key:InChIKey=IYKGFDKPPCITJX-UHFFFAOYSA-N
SMILES:FC=1C=C(C2=CC=C(N(=O)=O)C=C2)C=CC1
Synonyms:- 1,1′-Biphenyl, 3-fluoro-4′-nitro-
- 3-Fluoro-4′-nitro-1,1′-biphenyl
- 1-Fluoro-3-(4-nitrophenyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
