CAS 721-37-9
:3-trifluoromethyl-A,A,A-trifluoroacetophenone
Description:
3-Trifluoromethyl-A,A,A-trifluoroacetophenone, with the CAS number 721-37-9, is an organic compound characterized by its trifluoromethyl and trifluoroacetyl functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its strong electron-withdrawing properties due to the presence of multiple fluorine atoms, which significantly influence its reactivity and stability. The trifluoromethyl group enhances lipophilicity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound exhibits notable spectral characteristics, making it amenable to analysis via techniques such as NMR and IR spectroscopy. Its unique structure contributes to its potential utility in research and industrial applications, particularly in the development of fluorinated compounds. However, handling precautions are necessary due to the toxicity and environmental impact associated with fluorinated substances.
Formula:C9H4F6O
InChI:InChI=1/C9H4F6O/c10-8(11,12)6-3-1-2-5(4-6)7(16)9(13,14)15/h1-4H
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)C(F)(F)F
Synonyms:- 2,2,2-Trifluoro-3-(trifluoromethyl)-acetophenone
- 2,2,2-Trifluoro-1-[3-(Trifluoromethyl)Phenyl]Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone
CAS:Formula:C9H4F6OPurity:97%Color and Shape:LiquidMolecular weight:242.11792,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone
CAS:2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenoneFormula:C9H4F6OPurity:97%Color and Shape: clear. colourless liquidMolecular weight:242.11787g/mol2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone
CAS:Formula:C9H4F6OPurity:97%Color and Shape:LiquidMolecular weight:242.122,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone
CAS:2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone is a layered compound that has been used to test the reaction of sulfur with industrial and research nitro compounds. It is also used in the synthesis of trifluoroacetic acid catalysts. The chemical structure of 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone was determined by analyzing its sulfur content and comparing it to other similar compounds. This compound has been shown to be an efficient catalyst system for the ionizing chemistry of trifluoroacetic acid.Formula:C9H4F6OPurity:Min. 95%Molecular weight:242.12 g/mol



