CymitQuimica logo

CAS 721-63-1

:

Ethyl [4-(trifluoromethyl)phenyl]acetate

Description:
Ethyl [4-(trifluoromethyl)phenyl]acetate, with the CAS number 721-63-1, is an organic compound characterized by its ester functional group. It features an ethyl group attached to an acetate moiety, with a phenyl ring that has a trifluoromethyl substituent at the para position. This structure imparts unique properties, including increased lipophilicity and potential biological activity due to the presence of the trifluoromethyl group, which can enhance the compound's stability and reactivity. Ethyl [4-(trifluoromethyl)phenyl]acetate is typically a colorless liquid with a pleasant odor, making it useful in various applications, including as a solvent or in the synthesis of other chemical compounds. Its physical properties, such as boiling point and solubility, are influenced by the ester and aromatic functionalities. Additionally, the trifluoromethyl group can affect the compound's interaction with biological systems, making it of interest in medicinal chemistry and agrochemical research. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C11H11F3O2
InChI:InChI=1/C11H11F3O2/c1-2-16-10(15)7-8-3-5-9(6-4-8)11(12,13)14/h3-6H,2,7H2,1H3
InChI key:BDVKGYOFECBKDX-UHFFFAOYSA-N
SMILES:CCOC(=O)Cc1ccc(cc1)C(F)(F)F
Synonyms:
  • Benzeneacetic acid, 4-(trifluoromethyl)-, ethyl ester
Found 5 products.