CAS 72103-53-8
:tuftsin acetate
Description:
Tuftsin acetate, with the CAS number 72103-53-8, is a synthetic peptide derived from the natural immune modulator tuftsin, which is a fragment of the immunoglobulin G (IgG) molecule. This compound is known for its immunostimulatory properties, enhancing the activity of macrophages and promoting the immune response. Tuftsin acetate is typically characterized by its ability to modulate immune functions, making it of interest in immunology and potential therapeutic applications. It is often studied for its role in enhancing phagocytosis and cytokine production, which can be beneficial in various medical conditions, including infections and cancer. The acetate form indicates that it is a salt or ester derived from acetic acid, which can influence its solubility and stability. Overall, tuftsin acetate represents a significant area of research in the development of immune therapies and understanding immune system modulation.
Formula:C23H44N8O8
InChI:InChI=1/C21H40N8O6.C2H4O2/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25;1-2(3)4/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26);1H3,(H,3,4)
SMILES:CC(C(C(=NC(CCCCN)C(=O)N1CCCC1C(=NC(CCCNC(=N)N)C(=O)O)O)O)N)O.CC(=O)O
Synonyms:- L-Arginine, N2-(1-(N2-L-threonyl-L-lysyl)-L-prolyl)-, diacetate (salt)4
- L-threonyl-L-lysyl-L-prolyl-N~5~-(diaminomethylidene)-L-ornithine acetate (1:2)
- threonyllysylprolyl-N~5~-(diaminomethylidene)ornithine acetate (1:1)
- Tuftsin Acetate Salt
- tuftsin acetate
- THR-LYS-PRO-ARG ACETATE SALT
- tuftsin acetate salt hydrate
- H-THR-LYS-PRO-ARG-OH ACETATE SALT
- H-THR-LYS-PRO-ARG-OH ACOH
- Tuftsin diacetate
- TUFTSIN
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tuftsin diacetate
CAS:Tuftsin diacetate, Thr-Lys-Pro-Arg, activates macrophages/microglia; it's in immunoglobulin G's Fc and boosts immunity.Formula:C25H48N8O10Purity:98%Color and Shape:SolidMolecular weight:620.7Tuftsin
CAS:Controlled ProductTuftsin is a cyclic peptide that has been shown to have various biological properties, including anti-inflammatory and immunosuppressive activity. Tuftsin has been shown to inhibit the production of proinflammatory cytokines such as IL-10 by T cells in vitro. Tuftsin also inhibits the activation of toll-like receptors (TLR) and may have a role in inhibiting mycobacterial infection. This drug was found to be well tolerated in humans with congestive heart failure, and is currently being evaluated for its potential use as an adjunct therapy for inflammatory bowel disease. It has also been shown to be effective against opportunistic fungal infections, such as Candida albicans, Cryptococcus neoformans, and Aspergillus fumigatus. Tuftsin can be measured using analytical methods such as titration calorimetry or polymerase chain reaction (PCR).Formula:C21H40N8O6•2CH3COOH•4H2OPurity:Min. 95%Molecular weight:692.75 g/molTuftsin diacetate
CAS:Controlled ProductTuftsin diacetate is a synthetic peptide derivative, which is a modified form of the natural tetrapeptide tuftsin. This product originates from the enzymatic action on the Fc region of the gamma heavy chain of immunoglobulin G. Tuftsin diacetate functions by enhancing the phagocytic activity of macrophages and neutrophils, leading to an amplified immune response. Its mode of action involves binding to specific cell surface receptors, which stimulates these immune cells and promotes pathogen clearance.Formula:C23H44N8O8Purity:Min. 95%Molecular weight:560.6 g/mol

