CAS 72108-02-2

2-[3-(morpholin-4-yl)propoxy]benzaldehyde

Description:

2-[3-(Morpholin-4-yl)propoxy]benzaldehyde, with the CAS number 72108-02-2, is an organic compound characterized by its benzaldehyde functional group and a morpholine moiety. This compound features a benzene ring substituted with an aldehyde group and a propoxy chain that connects to a morpholine ring, which is a six-membered heterocyclic structure containing one oxygen and five carbon atoms. The presence of the morpholine group imparts certain properties, such as potential solubility in polar solvents and the ability to engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the benzene ring and the morpholine nitrogen. Overall, 2-[3-(morpholin-4-yl)propoxy]benzaldehyde is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1/C14H19NO3/c16-12-13-4-1-2-5-14(13)18-9-3-6-15-7-10-17-11-8-15/h1-2,4-5,12H,3,6-11H2

SMILES: c1ccc(c(c1)C=O)OCCCN1CCOCC1

Synonyms:

• Benzaldehyde, 2-[3-(4-Morpholinyl)Propoxy]-
• 2-[3-(Morpholin-4-yl)propoxy]benzaldehyde