CAS 72116-70-2
:N-(3-Acetylphenyl)-4-chlorobenzeneacetamide
Description:
N-(3-Acetylphenyl)-4-chlorobenzeneacetamide, with the CAS number 72116-70-2, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a 4-chlorobenzene ring and an acetylphenyl moiety, contributing to its unique chemical properties. It typically exhibits moderate solubility in organic solvents, reflecting its aromatic structure. The presence of the acetyl group suggests potential reactivity in nucleophilic substitution reactions, while the chlorobenzene component may influence its electronic properties and stability. This compound may be of interest in pharmaceutical research and development due to its structural features, which could impart biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C16H14ClNO2
InChI:InChI=1S/C16H14ClNO2/c1-11(19)13-3-2-4-15(10-13)18-16(20)9-12-5-7-14(17)8-6-12/h2-8,10H,9H2,1H3,(H,18,20)
InChI key:InChIKey=SFNFPRSEHQRYSK-UHFFFAOYSA-N
SMILES:N(C(CC1=CC=C(Cl)C=C1)=O)C2=CC(C(C)=O)=CC=C2
Synonyms:- Benzeneacetamide, N-(3-acetylphenyl)-4-chloro-
- N-(3-Acetylphenyl)-4-chlorobenzeneacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.