CymitQuimica logo

CAS 72130-68-8

:

Ethyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylate

Description:
Ethyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylate, with the CAS number 72130-68-8, is a chemical compound that belongs to the class of indolizine derivatives. This compound features a tetrahydroindolizine core, which is characterized by a fused bicyclic structure containing nitrogen. The presence of a carboxylate group and a hydroxyl group contributes to its potential reactivity and solubility in various solvents. Ethyl esters, like this compound, are often used in organic synthesis and medicinal chemistry due to their ability to undergo hydrolysis and other transformations. The keto group in the structure may also participate in tautomeric equilibria, influencing its chemical behavior. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmacological research. Overall, the unique structural features of Ethyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxylate suggest potential applications in various fields, including drug development and organic synthesis.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-2-16-11(15)10-7-4-3-5-12(7)9(14)6-8(10)13/h6,13H,2-5H2,1H3
InChI key:NWSKLPDPUFBJDU-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c2CCCn2c(=O)cc1O
Synonyms:
  • 1,2,3,5-Tetrahydro-7-hydroxy-5-oxo-8-indolizinecarboxylic acid ethyl ester
Found 4 products.