CymitQuimica logo

CAS 72133-30-3

:

5-(4-aminophenoxy)pyridine-2-carboxylic acid dihydrochloride

Description:
5-(4-Aminophenoxy)pyridine-2-carboxylic acid dihydrochloride is a chemical compound characterized by its specific functional groups and structure. It features a pyridine ring substituted with a carboxylic acid and an aminophenoxy group, which contributes to its potential biological activity. The dihydrochloride form indicates that the compound is a salt, typically enhancing its solubility in water, which is advantageous for various applications, particularly in pharmaceutical contexts. This compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. Additionally, the presence of both amine and carboxylic acid functional groups suggests it may participate in hydrogen bonding, influencing its reactivity and solubility. Overall, 5-(4-aminophenoxy)pyridine-2-carboxylic acid dihydrochloride is a compound of interest due to its unique structural features and potential applications in research and therapeutics.
Formula:C12H12Cl2N2O3
InChI:InChI=1/C12H10N2O3.2ClH/c13-8-1-3-9(4-2-8)17-10-5-6-11(12(15)16)14-7-10;;/h1-7H,13H2,(H,15,16);2*1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.