CAS 72133-34-7

5-(3-chlorophenoxy)pyridine-2-carboxylic acid

Description:

5-(3-Chlorophenoxy)pyridine-2-carboxylic acid is an organic compound characterized by its pyridine and carboxylic acid functional groups, along with a chlorophenoxy substituent. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure includes a pyridine ring, which contributes to its aromatic properties, and a carboxylic acid group that can participate in hydrogen bonding, influencing its reactivity and solubility. The presence of the 3-chlorophenoxy group enhances its biological activity and may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is often utilized in research and development, particularly in the synthesis of agrochemicals or pharmaceuticals. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, it may pose health risks if not managed properly. Overall, 5-(3-chlorophenoxy)pyridine-2-carboxylic acid is a versatile compound with applications in various chemical research fields.

Formula: C₁₂H₈ClNO₃

InChI: InChI=1/C12H8ClNO3/c13-8-2-1-3-9(6-8)17-10-4-5-11(12(15)16)14-7-10/h1-7H,(H,15,16)

SMILES: c1cc(cc(c1)Oc1ccc(C(=O)O)nc1)Cl

5-(3-Chlorophenoxy)pyridine-2-carboxylic acid

CAS: 72133-34-7

Versatile small molecule scaffold

Formula: C₁₂H₈ClNO₃

Purity: Min. 95%

Molecular weight: 249.65 g/mol

Ref: 3D-XCA13334