
CAS 72133-44-9
:5-[(5,5,5-Trifluoropentyl)oxy]-2-pyridinecarboxylic acid
Description:
5-[(5,5,5-Trifluoropentyl)oxy]-2-pyridinecarboxylic acid, with the CAS number 72133-44-9, is an organic compound characterized by its pyridine ring structure substituted with a carboxylic acid group and an ether linkage to a trifluoropentyl group. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of the hydrophilic carboxylic acid and the hydrophobic trifluoropentyl moiety. The trifluoropentyl group contributes to its lipophilicity and may influence its solubility in organic solvents. The compound may also display interesting biological activity due to the presence of the pyridine ring, which is known for its role in various pharmacological applications. Additionally, the trifluoromethyl group can enhance metabolic stability and alter the compound's interaction with biological targets. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C11H12F3NO3
InChI:InChI=1/C11H12F3NO3/c12-11(13,14)5-1-2-6-18-8-3-4-9(10(16)17)15-7-8/h3-4,7H,1-2,5-6H2,(H,16,17)
SMILES:C(CCOc1ccc(C(=O)O)nc1)CC(F)(F)F
Synonyms:- Trifluoropentoxypicolinic acid
- Nd-186 H-5
- 5-(5,5,5-Trifluoropentoxy)picolinic acid
- 5-[(5,5,5-Trifluoropentyl)Oxy]Pyridine-2-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.