CymitQuimica logo

CAS 72138-91-1

:

2-(2,2-Dimethoxyethoxy)-1,3-dimethylbenzene

Description:
2-(2,2-Dimethoxyethoxy)-1,3-dimethylbenzene, also known by its CAS number 72138-91-1, is an organic compound characterized by its aromatic structure, which includes a dimethyl-substituted benzene ring. This compound features a 2-(2,2-dimethoxyethoxy) group, contributing to its solubility and reactivity. The presence of the dimethoxyethoxy moiety enhances its polarity, making it more soluble in polar solvents compared to non-polar solvents. The compound is likely to exhibit moderate volatility and may have a relatively low boiling point due to its aromatic nature. It may also participate in various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Additionally, the presence of ether linkages suggests potential applications in organic synthesis or as a solvent. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's unique structure may lend itself to various applications in chemical research and industry.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-9-6-5-7-10(2)12(9)15-8-11(13-3)14-4/h5-7,11H,8H2,1-4H3
InChI key:InChIKey=FYQURTMVHVDCSH-UHFFFAOYSA-N
SMILES:O(CC(OC)OC)C1=C(C)C=CC=C1C
Synonyms:
  • Benzene, 2-(2,2-dimethoxyethoxy)-1,3-dimethyl-
  • 2-(2,2-Dimethoxyethoxy)-1,3-dimethylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.