CAS 7214-61-1
:(1-nitroethyl)benzene
Description:
(1-Nitroethyl)benzene, with the CAS number 7214-61-1, is an organic compound that features a nitro group (-NO2) attached to an ethyl group, which is further connected to a benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the nitro group introduces polar characteristics, making (1-nitroethyl)benzene more soluble in polar solvents compared to non-polar solvents. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The compound is known for its potential use in organic synthesis and as an intermediate in the production of various chemicals. It may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Additionally, (1-nitroethyl)benzene can participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro group, influencing its reactivity in chemical processes.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3
SMILES:CC(c1ccccc1)N(=O)=O
Synonyms:- 1-Nitro-1-phenylethane
- Benzene, (1-nitroethyl)-
- o-Nitroethylbenzene
- p-Nitroethylbenzene
- (1-NITROETHYL)BENZENE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(1-Nitroethyl)benzene
CAS:(1-Nitroethyl)benzene is a chloride that belongs to the family of muscarinic receptor antagonists. Its amide form is used in medicine as an antiviral agent, and it has been shown to be effective against HIV. (1-Nitroethyl)benzene also binds to the adenosine A3 receptor, which inhibits autoimmune diseases by preventing the proliferation of lymphocytes. The nitro group on this molecule can undergo a number of chemical reactions, including addition with alkylsulfonyl chloride or nitration with nitric acid.Formula:C8H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:151.16 g/mol





