CAS 72141-43-6
:1-Piperazinyl[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]phenyl]methanone
Description:
1-Piperazinyl[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]phenyl]methanone, identified by its CAS number 72141-43-6, is a chemical compound that features a piperazine moiety, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound is characterized by its complex structure, which includes a quinoline ring substituted with a trifluoromethyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the methanone functional group indicates that it may exhibit ketone-like reactivity. Such compounds are often studied for their pharmacological properties, particularly in medicinal chemistry, where they may serve as potential drug candidates due to their ability to interact with biological targets. The trifluoromethyl group is known to improve metabolic stability and bioavailability. Overall, this compound's unique structural features suggest it may have applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C21H19F3N4O
InChI:InChI=1S/C21H19F3N4O/c22-21(23,24)15-3-6-17-18(7-8-26-19(17)13-15)27-16-4-1-14(2-5-16)20(29)28-11-9-25-10-12-28/h1-8,13,25H,9-12H2,(H,26,27)
InChI key:InChIKey=QLOJSDFOYLGRGV-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(C(F)(F)F)C=C2)N=CC1)C3=CC=C(C(=O)N4CCNCC4)C=C3
Synonyms:- 1-Piperazinyl[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]phenyl]methanone
- Methanone, 1-Piperazinyl[4-[[7-(Trifluoromethyl)-4-Quinolinyl]Amino]Phenyl]-
- Piperazin-1-Yl(4-{[7-(Trifluoromethyl)Quinolin-4-Yl]Amino}Phenyl)Methanone
- Piperazine, 1-[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]benzoyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.