CAS 72142-88-2
:bis[(~2~H_3_)methyl]cyanamide
Description:
Bis[(~2~H_3_)methyl]cyanamide, with the CAS number 72142-88-2, is a chemical compound characterized by its unique structure, which includes a cyanamide functional group and two deuterated methyl groups. This compound is typically used in research and industrial applications, particularly in the synthesis of various organic compounds. Its deuterated nature makes it valuable in studies involving isotopic labeling, allowing for tracing and analysis in chemical reactions. The presence of the cyanamide group imparts specific reactivity, making it a potential intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as solubility and stability, can vary depending on environmental conditions like temperature and pH. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, bis[(~2~H_3_)methyl]cyanamide serves as an important tool in both academic and industrial chemistry settings.
Formula:C3D6N2
InChI:InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3/i1D3,2D3
SMILES:C(N(C([2H])([2H])[2H])C#N)([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl-d6-cyanamide
CAS:Controlled ProductApplications Dimethyl-d6-cyanamide (cas# 72142-88-2) is a compound useful in organic synthesis.
Formula:C3D6N2Color and Shape:NeatMolecular weight:76.13
