CAS 721453-52-7

3-[(4-bromobenzyl)amino]propan-1-ol

Description:

3-[(4-bromobenzyl)amino]propan-1-ol, with the CAS number 721453-52-7, is an organic compound characterized by its amine and alcohol functional groups. It features a propanol backbone, which contributes to its solubility in polar solvents, and a bromobenzyl group that enhances its hydrophobic characteristics. The presence of the bromine atom introduces significant electronegativity, potentially influencing the compound's reactivity and biological activity. This compound may exhibit properties typical of both amines and alcohols, such as hydrogen bonding capabilities, which can affect its interaction with other molecules. Additionally, the bromobenzyl moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the synthesis of compounds targeting various biological pathways. However, detailed studies would be necessary to fully understand its behavior, including its stability, reactivity, and potential toxicity.

Formula: C₁₀H₁₄BrNO

InChI: InChI=1/C10H14BrNO/c11-10-4-2-9(3-5-10)8-12-6-1-7-13/h2-5,12-13H,1,6-8H2

SMILES: C(CNCc1ccc(cc1)Br)CO

Synonyms:

• 1-Propanol, 3-[[(4-Bromophenyl)Methyl]Amino]-
• AKOS LT-992X0035
• 3-[(4-bromobenzyl)amino]-1-propanol
• UKRORGSYN-BB BBV-175050
• 3-[(4-bromobenzyl)amino]-1-propanol(SALTDATA: HCl)

3-[(4-bromobenzyl)amino]-1-propanol hydrochloride

CAS: 721453-52-7

Formula: C₁₀H₁₅BrClNO

Purity: 95.0%

Molecular weight: 280.59

Ref: 10-F361792