CAS 7215-02-3
:3-(4-chlorophenyl)azetidine
Description:
3-(4-Chlorophenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 4-chlorophenyl group indicates that a chlorinated phenyl substituent is attached to the azetidine ring at the third position. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic component. The chlorophenyl group can influence the compound's reactivity and biological activity, potentially making it of interest in medicinal chemistry and drug development. The azetidine ring itself is known for its strain and can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions. Overall, 3-(4-chlorophenyl)azetidine is a compound that may be studied for its synthetic applications and potential pharmacological properties, although specific biological activities would require further investigation.
Formula:C9H10ClN
InChI:InChI=1/C9H10ClN/c10-9-3-1-7(2-4-9)8-5-11-6-8/h1-4,8,11H,5-6H2
SMILES:c1cc(ccc1C1CNC1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.