CAS 7215-03-4

4-(azetidin-3-yl)benzonitrile

Description:

4-(Azetidin-3-yl)benzonitrile, identified by its CAS number 7215-03-4, is an organic compound characterized by the presence of both a benzonitrile group and an azetidine ring. The azetidine moiety is a four-membered saturated heterocycle containing one nitrogen atom, which contributes to the compound's unique properties. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature. The presence of the nitrile functional group (-C≡N) imparts notable reactivity, making it a potential candidate for various chemical transformations and applications in medicinal chemistry. The azetidine ring can influence the compound's biological activity, potentially enhancing its interaction with biological targets. Overall, 4-(azetidin-3-yl)benzonitrile is of interest in research contexts, particularly in the development of pharmaceuticals and agrochemicals, due to its structural features that may confer specific biological activities.

Formula: C₁₀H₁₀N₂

InChI: InChI=1/C10H10N2/c11-5-8-1-3-9(4-2-8)10-6-12-7-10/h1-4,10,12H,6-7H2

SMILES: c1cc(ccc1C#N)C1CNC1

4-(Azetidin-3-yl)benzonitrile

CAS: 7215-03-4

Formula: C₁₀H₁₀N₂

Purity: 95%

Molecular weight: 158.1998

Ref: IN-DA01DMFZ

4-(Azetidin-3-yl)benzonitrile

CAS: 7215-03-4

Formula: C₁₀H₁₀N₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 158.204

Ref: 10-F388372