CAS 7215-09-0
:1-methyl-3-phenylazetidine
Description:
1-Methyl-3-phenylazetidine is a cyclic amine characterized by its four-membered ring structure containing a nitrogen atom. This compound features a methyl group attached to the nitrogen and a phenyl group attached to the carbon chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the phenyl group enhances its aromatic characteristics, which can influence its reactivity and interactions with other chemical species. 1-Methyl-3-phenylazetidine is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its chemical behavior is influenced by the azetidine ring, which can undergo various reactions such as nucleophilic substitutions and ring-opening reactions. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13N
InChI:InChI=1/C10H13N/c1-11-7-10(8-11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.