CAS 7215-16-9
:1-benzyl-3-phenylazetidine
Description:
1-Benzyl-3-phenylazetidine, with the CAS number 7215-16-9, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing nitrogen. This particular azetidine derivative features a benzyl group and a phenyl group attached to the nitrogen and carbon atoms of the ring, respectively. The presence of these aromatic groups contributes to its potential for various chemical reactivity and biological activity. Typically, compounds like 1-benzyl-3-phenylazetidine may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, owing to their hydrophobic aromatic components. The compound may also participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it of interest in synthetic organic chemistry. Additionally, its structural features may confer specific pharmacological properties, which could be explored in medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.
Formula:C16H17N
InChI:InChI=1/C16H17N/c1-3-7-14(8-4-1)11-17-12-16(13-17)15-9-5-2-6-10-15/h1-10,16H,11-13H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
