CAS 7215-25-0
:3-benzyl-3-phenylazetidine
Description:
3-Benzyl-3-phenylazetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. This compound features two phenyl groups, one attached to the nitrogen atom and the other to a carbon atom in the azetidine ring, contributing to its aromatic properties. The presence of these phenyl groups enhances the compound's stability and may influence its reactivity and solubility in various solvents. Typically, azetidine derivatives exhibit interesting biological activities, making them of interest in medicinal chemistry. The molecular structure of 3-benzyl-3-phenylazetidine suggests potential applications in drug development, particularly in the synthesis of novel pharmaceuticals. Additionally, the compound's physical properties, such as melting point and boiling point, would depend on its specific molecular interactions and purity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C16H17N
InChI:InChI=1/C16H17N/c1-3-7-14(8-4-1)11-16(12-17-13-16)15-9-5-2-6-10-15/h1-10,17H,11-13H2
SMILES:c1ccc(cc1)CC1(CNC1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.