CymitQuimica logo

CAS 7215-33-0

:

Diethylphosphine oxide

Description:
Diethylphosphine oxide is an organophosphorus compound characterized by its phosphine oxide functional group. It features a phosphorus atom bonded to two ethyl groups and an oxygen atom, which contributes to its polar nature. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents such as ether and alcohol but has limited solubility in water. Diethylphosphine oxide is known for its applications in organic synthesis, particularly as a ligand in coordination chemistry and as a reagent in various chemical reactions. It exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. The compound's reactivity is influenced by the presence of the phosphorus-oxygen bond, making it a valuable intermediate in the synthesis of other phosphorus-containing compounds. Additionally, it can participate in nucleophilic substitution reactions due to the presence of the phosphorus atom, which can act as a Lewis base. Overall, diethylphosphine oxide is a versatile compound with significant utility in both academic and industrial chemistry.
Formula:(CH3CH2)2PHO
InChI:InChI=1S/C4H10OP/c1-3-6(5)4-2/h3-4H2,1-2H3/q+1
InChI key:YVXVNGVYXSQARS-UHFFFAOYSA-N
SMILES:CC[P+](=O)CC
Found 2 products.