CAS 72152-84-2
:2,6,6-Trimethyl-1,3-cyclohexadiene-1-carbonitrile
Description:
2,6,6-Trimethyl-1,3-cyclohexadiene-1-carbonitrile, with the CAS number 72152-84-2, is an organic compound characterized by its unique structure, which includes a cyclohexadiene ring and a carbonitrile functional group. This compound features three methyl groups attached to the cyclohexadiene, contributing to its stability and reactivity. The presence of the carbonitrile group indicates that it has a strong dipole moment due to the electronegative nitrogen atom, which can influence its chemical behavior and interactions. Typically, compounds like this may exhibit properties such as volatility and potential reactivity with nucleophiles due to the presence of the carbonitrile group. Additionally, its structure suggests that it may participate in various chemical reactions, including electrophilic additions or substitutions. The compound's physical properties, such as boiling point and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 2,6,6-Trimethyl-1,3-cyclohexadiene-1-carbonitrile is of interest in organic synthesis and may have applications in various chemical processes.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-5-4-6-10(2,3)9(8)7-11/h4-5H,6H2,1-3H3
InChI key:InChIKey=MDBKXUUTSLSJDH-UHFFFAOYSA-N
SMILES:C(#N)C=1C(C)(C)CC=CC1C
Synonyms:- 1,3-Cyclohexadiene-1-Carbonitrile, 2,6,6-Trimethyl-
- 1-Cyano-2,6,6-trimethyl-1,3-cyclohexadiene
- 2,6,6-Trimethyl-1,3-cyclohexadiene-1-carbonitrile
- 2,6,6-Trimethylcyclohexa-1,3-dienecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,6,6-Trimethylcyclohexa-1,3-dien-1-ylcarbonitrile
CAS:Controlled ProductFormula:C10H13NColor and Shape:NeatMolecular weight:147.22
