CAS 72155-46-5

Ethyl 2,4,5-trideoxy-4-[[(1,1-dimethylethoxy)carbonyl]amino]-5-phenyl-L-threo-pentonate

Description:

Ethyl 2,4,5-trideoxy-4-[[(1,1-dimethylethoxy)carbonyl]amino]-5-phenyl-L-threo-pentonate, with the CAS number 72155-46-5, is a chemical compound characterized by its complex structure, which includes a pentonate backbone and various functional groups. This substance features a threo configuration, indicating a specific stereochemistry that influences its biological activity and reactivity. The presence of the ethyl ester group suggests that it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. The dimethylethoxycarbonyl group introduces steric hindrance, which can affect the compound's reactivity and interactions with biological targets. Additionally, the phenyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and permeability in biological systems. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and pharmaceutical applications, particularly in the development of novel therapeutic agents.

Formula: C₁₈H₂₇NO₅

InChI: InChI=1S/C18H27NO5/c1-5-23-16(21)12-15(20)14(11-13-9-7-6-8-10-13)19-17(22)24-18(2,3)4/h6-10,14-15,20H,5,11-12H2,1-4H3,(H,19,22)/t14-,15-/m0/s1

InChI key: InChIKey=YUDAODOOKYRWEP-GJZGRUSLSA-N

SMILES: [C@@H](CC1=CC=CC=C1)(NC(OC(C)(C)C)=O)[C@H](CC(OCC)=O)O

Synonyms:

• Ethyl 2,4,5-trideoxy-4-[[(1,1-dimethylethoxy)carbonyl]amino]-5-phenyl-L-threo-pentonate
• L-threo-Pentonic acid, 2,4,5-trideoxy-4-[[(1,1-dimethylethoxy)carbonyl]amino]-5-phenyl-, ethyl ester