CymitQuimica logo

CAS 72155-51-2

:

4-Amino-2,4,5-trideoxy-5-phenyl-L-erythro-pentonic acid

Description:
4-Amino-2,4,5-trideoxy-5-phenyl-L-erythro-pentonic acid, with the CAS number 72155-51-2, is a carbohydrate derivative characterized by its unique structural features. This compound contains an amino group, which contributes to its potential biological activity, and a phenyl group that enhances its hydrophobic characteristics. The presence of multiple hydroxyl groups in its structure indicates that it can engage in hydrogen bonding, influencing its solubility and reactivity. As a pentonic acid, it is part of the pentose family of sugars, which are essential in various biochemical processes, including nucleic acid synthesis. The erythro configuration suggests specific stereochemical properties that may affect its interaction with biological macromolecules. This compound may have applications in medicinal chemistry or biochemistry, particularly in the study of glycosylation processes or as a potential precursor in the synthesis of more complex molecules. Overall, its unique combination of functional groups and stereochemistry makes it a compound of interest in both research and potential therapeutic applications.
Formula:C11H15NO3
InChI:InChI=1S/C11H15NO3/c12-9(10(13)7-11(14)15)6-8-4-2-1-3-5-8/h1-5,9-10,13H,6-7,12H2,(H,14,15)/t9-,10+/m0/s1
InChI key:InChIKey=JAJQQUQHMLWDFB-VHSXEESVSA-N
SMILES:C([C@@H]([C@@H](CC(O)=O)O)N)C1=CC=CC=C1
Synonyms:
  • 4-Amino-2,4,5-trideoxy-5-phenyl-L-erythro-pentonic acid
  • Phenylstatine
  • L-erythro-Pentonic acid, 4-amino-2,4,5-trideoxy-5-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.