CAS 72156-72-0
:phenacetin-ethoxy-1-13C
Description:
Phenacetin-ethoxy-1-13C is a derivative of phenacetin, which is an analgesic and antipyretic compound historically used for pain relief and fever reduction. The "ethoxy" designation indicates the presence of an ethoxy group, which can influence the compound's solubility and biological activity. The "1-13C" notation signifies that one of the carbon atoms in the molecule is a stable isotope of carbon, specifically carbon-13, which is often used in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques to trace metabolic pathways or study molecular structures. The CAS number 72156-72-0 uniquely identifies this specific compound in chemical databases. Phenacetin itself has been associated with various health concerns, including potential nephrotoxicity and carcinogenicity, leading to its withdrawal from the market in many countries. The incorporation of the ethoxy group and the carbon-13 isotope may alter its pharmacokinetic properties, making it a subject of interest in research, particularly in studies involving drug metabolism and isotopic labeling.
Formula:C913CH13NO2
InChI:InChI=1/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12)/i3+1
Synonyms:- N-(4-ethoxyphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.