CymitQuimica logo

CAS 72159-22-9

:

2-(1H-Pyrazol-3-yl)-1H-isoindole-1,3(2H)-dione

Description:
2-(1H-Pyrazol-3-yl)-1H-isoindole-1,3(2H)-dione, with the CAS number 72159-22-9, is a chemical compound that features a unique structure combining an isoindole moiety with a pyrazole ring. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its heterocyclic nature. The presence of both the pyrazole and isoindole rings suggests that it may possess interesting biological activities, possibly acting as a ligand or a precursor in various chemical reactions. Its molecular structure may contribute to its solubility in organic solvents, while its stability can vary depending on environmental conditions such as temperature and pH. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical applications. Overall, 2-(1H-Pyrazol-3-yl)-1H-isoindole-1,3(2H)-dione is of interest for further research in the fields of organic synthesis and pharmacology.
Formula:C11H7N3O2
InChI:InChI=1S/C11H7N3O2/c15-10-7-3-1-2-4-8(7)11(16)14(10)9-5-6-12-13-9/h1-6H,(H,12,13)
InChI key:InChIKey=TXJMOUZMFKYCOY-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=2C1=CC=CC2)C=3C=CNN3
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-(1H-pyrazol-3-yl)-
  • 2-(1H-Pyrazol-3-yl)-1H-isoindole-1,3(2H)-dione
  • 2-(1H-Pyrazol-3-yl)isoindole-1,3-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.