
CAS 7216-19-5
:1,5-Dihydro-2,4-benzodithiepin
Description:
1,5-Dihydro-2,4-benzodithiepin, with the CAS number 7216-19-5, is a heterocyclic organic compound characterized by its unique structure that includes a benzene ring fused with a dithiepin moiety. This compound features a bicyclic system containing sulfur atoms, which contributes to its distinct chemical properties. Typically, compounds of this nature exhibit interesting reactivity due to the presence of the sulfur atoms, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. The presence of the benzene ring also imparts aromatic stability, influencing the compound's solubility and interaction with other substances. 1,5-Dihydro-2,4-benzodithiepin may have applications in medicinal chemistry and materials science, although specific uses can vary based on its reactivity and biological activity. As with many sulfur-containing compounds, it may exhibit unique electronic properties, making it a subject of interest in research related to organic electronics and photonics. Safety and handling precautions should be observed due to potential toxicity associated with sulfur-containing heterocycles.
Formula:C9H10S2
InChI:InChI=1S/C9H10S2/c1-2-4-9-6-11-7-10-5-8(9)3-1/h1-4H,5-7H2
InChI key:InChIKey=XKBZAEGUFRRDCW-UHFFFAOYSA-N
SMILES:C=12C(=CC=CC1)CSCSC2
Synonyms:- o-Xylylenemethylene disulfide
- 1,5-Dihydro-2,4-benzodithiepin
- 2,4-Benzodithiepin, 1,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.