
CAS 72169-17-6
:(T-4)-Trichloro[1,1,1-tris(1,1-dimethylethyl)silanamine]boron
Description:
(T-4)-Trichloro[1,1,1-tris(1,1-dimethylethyl)silanamine]boron, with the CAS number 72169-17-6, is a chemical compound that belongs to the class of organosilicon compounds. It features a boron atom coordinated to a silanamine group, which is further substituted with three bulky tert-butyl groups. This structure imparts unique steric and electronic properties, making it useful in various applications, particularly in the field of materials science and catalysis. The presence of chlorine atoms enhances its reactivity, allowing it to participate in various chemical reactions, including those involving silicon and boron chemistry. The compound is typically characterized by its stability under ambient conditions, although it may be sensitive to moisture and air, necessitating careful handling and storage. Its applications may include use as a reagent in organic synthesis, as well as potential roles in the development of advanced materials or as a catalyst in specific chemical processes. Safety precautions should be observed due to its chemical reactivity and potential toxicity.
Formula:C12H29BCl3NSi
InChI:InChI=1S/C12H29BCl3NSi/c1-10(2,3)18(11(4,5)6,12(7,8)9)17-13(14,15)16/h17H2,1-9H3
InChI key:InChIKey=HJLRZHJKCXDDNQ-UHFFFAOYSA-N
SMILES:[Si]([NH2][B+3]([Cl-])([Cl-])[Cl-])(C(C)(C)C)(C(C)(C)C)C(C)(C)C
Synonyms:- Boron, trichloro[1,1,1-tris(1,1-dimethylethyl)silanamine]-, (T-4)-
- Silanamine, 1,1,1-tris(1,1-dimethylethyl)-, boron complex
- Borane, trichloro-, compd. with 1,1,1-tris(1,1-dimethylethyl)silanamine (1:1)
- Silanamine, 1,1,1-tris(1,1-dimethylethyl)-, compd. with trichloroborane (1:1)
- (T-4)-Trichloro[1,1,1-tris(1,1-dimethylethyl)silanamine]boron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
