CAS 7218-24-8

2-(2-Chloroacetyl)-1H-isoindole-1,3(2H)-dione

Description:

2-(2-Chloroacetyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 7218-24-8, is a chemical compound that belongs to the class of isoindole derivatives. It features a chloroacetyl group attached to the isoindole structure, which contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits a solid state at room temperature and is characterized by its distinct functional groups, which can influence its chemical behavior, such as reactivity towards nucleophiles or electrophiles. The presence of the chloroacetyl moiety may impart biological activity, making it of interest in medicinal chemistry. Additionally, its molecular structure suggests potential for various interactions, including hydrogen bonding and π-π stacking, which can affect its solubility and stability in different solvents. Overall, 2-(2-Chloroacetyl)-1H-isoindole-1,3(2H)-dione is a versatile compound that may serve as a building block in the synthesis of more complex molecules or as a lead compound in drug discovery.

Formula: C₁₀H₆ClNO₃

InChI: InChI=1S/C10H6ClNO3/c11-5-8(13)12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4H,5H2

InChI key: InChIKey=MHOLXDZIPDVQRT-UHFFFAOYSA-N

SMILES: C(CCl)(=O)N1C(=O)C=2C(C1=O)=CC=CC2

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-(chloroacetyl)-
• 2-(chloroacetyl)-1H-isoindole-1,3(2H)-dione
• 2-(2-Chloroacetyl)-1H-isoindole-1,3(2H)-dione
• Phthalimide, N-(chloroacetyl)-
• N-(Chloroacetyl)phthalimide
• N-Chloroacetylphthalimide
• 1H-Isoindole-1,3(2H)-dione, 2-(2-chloroacetyl)-