CAS 7218-27-1
:N-(2-chloroacetyl)benzamide
Description:
N-(2-chloroacetyl)benzamide is an organic compound characterized by its amide functional group and a chloroacetyl substituent. It features a benzene ring attached to an amide group, which is further substituted with a 2-chloroacetyl moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents. Its molecular structure suggests it may exhibit moderate polarity due to the presence of the amide and chloroacetyl groups. N-(2-chloroacetyl)benzamide can participate in various chemical reactions, including nucleophilic acyl substitution and can act as a potential intermediate in organic synthesis. The chloroacetyl group may impart reactivity, making it useful in the synthesis of other compounds. Additionally, due to its structural features, it may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted, as compounds containing chlorine can pose health risks, and appropriate handling and disposal procedures should be followed.
Formula:C9H8ClNO2
InChI:InChI=1/C9H8ClNO2/c10-6-8(12)11-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12,13)
SMILES:c1ccc(cc1)C(=O)N=C(CCl)O
Synonyms:- benzamide, N-(2-chloroacetyl)-
- N-(2-Chloro-acetyl)-benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.