CAS 72180-26-8

(s)-1-benzyl-2-methyl-4,4-difluoropyrrolidine-1,2-dicarb

Description:

The chemical substance (S)-1-benzyl-2-methyl-4,4-difluoropyrrolidine-1,2-dicarboxylic acid, identified by its CAS number 72180-26-8, is a chiral compound featuring a pyrrolidine ring with multiple functional groups. Its structure includes a benzyl group and two fluorine atoms attached to the pyrrolidine, contributing to its unique chemical properties. The presence of the dicarboxylic acid functionality suggests that it can participate in various chemical reactions, including esterification and amidation. The chirality of the molecule indicates that it may exhibit different biological activities depending on its stereochemistry, which is crucial in pharmaceutical applications. Additionally, the difluoromethyl substituents can enhance lipophilicity and influence the compound's interaction with biological targets. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, particularly in the design of selective agents with potential therapeutic effects.

Formula: C₁₄H₁₅F₂NO₄

InChI: InChI=1/C14H15F2NO4/c1-20-12(18)11-7-14(15,16)9-17(11)13(19)21-8-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3

SMILES: COC(=O)C1CC(CN1C(=O)OCc1ccccc1)(F)F

(S)-1-Benzyl-2-methyl-4,4-difluoropyrrolidine-1,2-dicarboxylic acid

CAS: 72180-26-8

Versatile small molecule scaffold

Formula: C₁₄H₁₅F₂NO₄

Purity: Min. 95%

Molecular weight: 299.27 g/mol

Ref: 3D-XCA18026