CAS 72187-39-4
:2-[2-(Phenylmethoxy)ethyl]pyridine
Description:
2-[2-(Phenylmethoxy)ethyl]pyridine, with the CAS number 72187-39-4, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a phenylmethoxy group attached to a 2-ethyl chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the pyridine moiety imparts basicity and potential for hydrogen bonding, while the phenylmethoxy group enhances its lipophilicity, making it soluble in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various interactions with biological targets, potentially influencing its pharmacological properties. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly. Overall, 2-[2-(Phenylmethoxy)ethyl]pyridine is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-2-6-13(7-3-1)12-16-11-9-14-8-4-5-10-15-14/h1-8,10H,9,11-12H2
InChI key:InChIKey=JUKWUVUJUABESO-UHFFFAOYSA-N
SMILES:C(OCCC1=CC=CC=N1)C2=CC=CC=C2
Synonyms:- 2-[2-(Benzyloxy)Ethyl]Pyridine
- NSC 34068
- Pyridine, 2-(2-(phenylmethoxy)ethyl)-
- 2-(2-(Phenylmethoxy)ethyl)pyridine
- 2-[2-(Phenylmethoxy)ethyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
