CAS 721876-16-0
:4-methylpiperazine-2-carboxylic acid
Description:
4-Methylpiperazine-2-carboxylic acid is an organic compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 2-position and a methyl group (-CH3) at the 4-position of the piperazine ring. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound may exhibit basic properties due to the nitrogen atoms in the piperazine ring, allowing it to participate in various chemical reactions, including amide formation and esterification. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drug candidates that target central nervous system disorders or as intermediates in organic synthesis. As with many piperazine derivatives, it may also exhibit biological activity, making it of interest in medicinal chemistry.
Formula:C6H12N2O2
InChI:InChI=1/C6H12N2O2/c1-8-3-2-7-5(4-8)6(9)10/h5,7H,2-4H2,1H3,(H,9,10)
SMILES:CN1CCNC(C1)C(=O)O
Synonyms:- 2-Piperazinecarboxylic Acid, 4-Methyl-
- 4-Methylpiperazine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
