CAS 7219-89-8
:Estriol 17-glucuronide
Description:
Estriol 17-glucuronide is a conjugated form of estriol, a naturally occurring estrogen, and is characterized by the addition of a glucuronic acid moiety at the 17-position of the estriol molecule. This modification enhances its solubility in water, facilitating its excretion from the body. Estriol itself is a weak estrogen, primarily produced during pregnancy, and plays a role in various physiological processes. Estriol 17-glucuronide is typically found in biological fluids, such as urine, where it serves as a metabolite of estriol. Its presence can be indicative of estrogen metabolism and is often measured in clinical settings to assess hormonal levels. The compound is generally stable under physiological conditions but may undergo hydrolysis under certain circumstances, releasing estriol. As a glucuronide, it is part of the body's detoxification processes, aiding in the elimination of excess hormones. Understanding its characteristics is essential for research in endocrinology and reproductive health, as well as for monitoring hormone-related conditions.
Formula:C24H32O9
InChI:InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(25)8-10(12)2-4-14(13)15(24)9-16(26)21(24)33-23-19(29)17(27)18(28)20(32-23)22(30)31/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/t13-,14-,15+,16-,17+,18+,19-,20+,21+,23+,24+/m1/s1
InChI key:InChIKey=CZGFLAQOJPXVRV-FLVROIOLSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](CC1)(C=4C(CC3)=CC(O)=CC4)[H])[H])(C[C@@H](O)[C@@H]2O[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)[H]
Synonyms:- Glucopyranosiduronic acid, 3,16α-dihydroxyestra-1,3,5(10)-trien-17β-yl, β-D-
- β-D-Glucopyranosiduronic acid, (16α,17β)-3,16-dihydroxyestra-1,3,5(10)-trien-17-yl
- Estriol 17β-monoglucuronide
- Estra-1,3,5(10)-triene-3,16α-diol, 17β-(β-D-glucopyranuronosyloxy)-
- (16α,17β)-3,16-Dihydroxyestra-1,3,5(10)-trien-17-yl β-D-glucopyranosiduronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
