CymitQuimica logo

CAS 721916-24-1

:

2-[4-[(Hydroxyimino)methyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide

Description:
2-[4-[(Hydroxyimino)methyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide is a complex organic compound characterized by its unique structural features, which include a hydroxyimino group, a methoxyphenoxy moiety, and a trimethylphenyl substituent. This compound likely exhibits properties typical of amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the presence of the hydroxyimino group. The methoxy group may enhance lipophilicity, while the hydroxyimino functionality could contribute to its reactivity and potential biological activity. The presence of multiple aromatic rings suggests that the compound may exhibit significant stability and could participate in π-π stacking interactions. Additionally, the trimethylphenyl group may influence the steric hindrance and electronic properties of the molecule, potentially affecting its interactions with biological targets. Overall, this compound's intricate structure suggests it may have applications in medicinal chemistry or as a research tool in various chemical and biological studies.
Formula:C19H22N2O4
InChI:InChI=1S/C19H22N2O4/c1-12-7-13(2)19(14(3)8-12)21-18(22)11-25-16-6-5-15(10-20-23)9-17(16)24-4/h5-10,23H,11H2,1-4H3,(H,21,22)
InChI key:InChIKey=YNRQMMJCNDHBTJ-UHFFFAOYSA-N
SMILES:O(CC(NC1=C(C)C=C(C)C=C1C)=O)C2=C(OC)C=C(C=NO)C=C2
Synonyms:
  • 2-[4-[(Hydroxyimino)methyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)acetamide
  • Acetamide, 2-[4-[(hydroxyimino)methyl]-2-methoxyphenoxy]-N-(2,4,6-trimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.