
CAS 721916-32-1
:4-(4-Chlorophenyl)-5-[(4-ethoxyphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-(4-Chlorophenyl)-5-[(4-ethoxyphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole core, which is a five-membered heterocyclic ring containing three nitrogen atoms. This compound features a chlorophenyl group and an ethoxyphenoxy side chain, contributing to its potential biological activity. The presence of the thione functional group indicates that it may exhibit properties typical of thioketones, such as reactivity with electrophiles. The compound's structure suggests it may have applications in pharmaceuticals or agrochemicals, particularly due to the presence of the triazole moiety, which is known for its antifungal and antimicrobial properties. Its solubility, stability, and reactivity can be influenced by the substituents on the triazole ring, making it a subject of interest for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, and its environmental impact should be assessed in any practical applications.
Formula:C17H16ClN3O2S
InChI:InChI=1S/C17H16ClN3O2S/c1-2-22-14-7-9-15(10-8-14)23-11-16-19-20-17(24)21(16)13-5-3-12(18)4-6-13/h3-10H,2,11H2,1H3,(H,20,24)
InChI key:InChIKey=LLOCAFRCJRZEJY-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(OCC)C=C1)C=2N(C(=S)NN2)C3=CC=C(Cl)C=C3
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-(4-chlorophenyl)-5-[(4-ethoxyphenoxy)methyl]-2,4-dihydro-
- 4-(4-Chlorophenyl)-5-[(4-ethoxyphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.