CymitQuimica logo

CAS 721927-08-8

:

4,5,6,7-Tetrahydrofuro[2,3-c]pyridine

Description:
4,5,6,7-Tetrahydrofuro[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused ring structure, which includes both a pyridine and a furan moiety. This compound features a bicyclic framework that contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of nitrogen in the pyridine ring imparts basicity, while the furan ring can participate in various chemical reactions due to its electron-rich nature. This compound is of interest in medicinal chemistry and organic synthesis, often serving as a building block for more complex molecules. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various applications in research and development. Additionally, the compound may exhibit biological activity, making it a candidate for further investigation in pharmacological studies. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H9NO
InChI:InChI=1S/C7H9NO/c1-3-8-5-7-6(1)2-4-9-7/h2,4,8H,1,3,5H2
InChI key:InChIKey=ZKAYEFAKZWTAGS-UHFFFAOYSA-N
SMILES:C12=C(OC=C1)CNCC2
Synonyms:
  • Furo[2,3-c]pyridine, 4,5,6,7-tetrahydro-
  • 4,5,6,7-Tetrahydrofuro[2,3-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.