CymitQuimica logo

CAS 721958-60-7

:

4-(2-Fluoro-4-nitrophenyl)piperidine

Description:
4-(2-Fluoro-4-nitrophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 2-fluoro-4-nitrophenyl group indicates that the compound has both a fluorine atom and a nitro group attached to a phenyl ring, contributing to its unique chemical properties. This structure suggests that the compound may exhibit significant polarity due to the electronegative fluorine and nitro groups, which can influence its solubility and reactivity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's behavior in chemical reactions, potentially making it a good candidate for various applications in medicinal chemistry or as an intermediate in organic synthesis. Additionally, the presence of the piperidine moiety may impart basic characteristics, allowing for interactions with biological targets. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be determined through experimental data and further analysis.
Formula:C11H13FN2O2
InChI:InChI=1S/C11H13FN2O2/c12-11-7-9(14(15)16)1-2-10(11)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2
InChI key:InChIKey=LEUQFRXZJITEGH-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(N(=O)=O)=C1)C2CCNCC2
Synonyms:
  • 4-(2-Fluoro-4-nitrophenyl)piperidine
  • Piperidine, 4-(2-fluoro-4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.